C10H10ClNS2 — CID 80528883
1-(3-chlorothiophen-2-yl)-N-methyl-1-thiophen-2-ylmethanamine (PubChem CID 80528883) has the molecular formula C10H10ClNS2 and a molecular weight of 243.78 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-methyl-1-thiophen-2-ylmethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-methyl-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 80528883 |
| Molecular Formula | C10H10ClNS2 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-methyl-1-thiophen-2-ylmethanamine |
| SMILES | CNC(c1cccs1)c1sccc1Cl |
| InChI | InChI=1S/C10H10ClNS2/c1-12-9(8-3-2-5-13-8)10-7(11)4-6-14-10/h2-6,9,12H,1H3 |
| InChIKey | MVRNMQRFHYRAQG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |