C12H15NS2 — CID 102841226
N-methyl-1-(2-methylthiophen-3-yl)-1-(3-methylthiophen-2-yl)methanamine (PubChem CID 102841226) has the molecular formula C12H15NS2 and a molecular weight of 237.39 g/mol. Its IUPAC name is N-methyl-1-(2-methylthiophen-3-yl)-1-(3-methylthiophen-2-yl)methanamine.
| Compound Name | N-methyl-1-(2-methylthiophen-3-yl)-1-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 102841226 |
| Molecular Formula | C12H15NS2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-methyl-1-(2-methylthiophen-3-yl)-1-(3-methylthiophen-2-yl)methanamine |
| SMILES | CNC(c1ccsc1C)c1sccc1C |
| InChI | InChI=1S/C12H15NS2/c1-8-4-6-15-12(8)11(13-3)10-5-7-14-9(10)2/h4-7,11,13H,1-3H3 |
| InChIKey | SBZAHIDYCYVLBV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |