C10H13N3S2 — CID 105166473
N-methyl-1-(4-methylthiadiazol-5-yl)-1-(3-methylthiophen-2-yl)methanamine (PubChem CID 105166473) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is N-methyl-1-(4-methylthiadiazol-5-yl)-1-(3-methylthiophen-2-yl)methanamine.
| Compound Name | N-methyl-1-(4-methylthiadiazol-5-yl)-1-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 105166473 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-methyl-1-(4-methylthiadiazol-5-yl)-1-(3-methylthiophen-2-yl)methanamine |
| SMILES | CNC(c1sccc1C)c1snnc1C |
| InChI | InChI=1S/C10H13N3S2/c1-6-4-5-14-9(6)8(11-3)10-7(2)12-13-15-10/h4-5,8,11H,1-3H3 |
| InChIKey | YGRXWWFNTBSPLU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |