C14H18N2S — CID 67733700
N-methyl-2-[methylamino-(3-methylthiophen-2-yl)methyl]aniline (PubChem CID 67733700) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-methyl-2-[methylamino-(3-methylthiophen-2-yl)methyl]aniline.
| Compound Name | N-methyl-2-[methylamino-(3-methylthiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 67733700 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-methyl-2-[methylamino-(3-methylthiophen-2-yl)methyl]aniline |
| SMILES | CNc1ccccc1C(NC)c1sccc1C |
| InChI | InChI=1S/C14H18N2S/c1-10-8-9-17-14(10)13(16-3)11-6-4-5-7-12(11)15-2/h4-9,13,15-16H,1-3H3 |
| InChIKey | JKKAOTCLWBYCSG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |