C14H13F3INS — CID 102758264
1-(5-iodothiophen-3-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102758264) has the molecular formula C14H13F3INS and a molecular weight of 411.23 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 1-(5-iodothiophen-3-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102758264 |
| Molecular Formula | C14H13F3INS |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-N-methyl-1-[2-methyl-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CNC(c1csc(I)c1)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C14H13F3INS/c1-8-5-10(14(15,16)17)3-4-11(8)13(19-2)9-6-12(18)20-7-9/h3-7,13,19H,1-2H3 |
| InChIKey | ACEJZEBNSCVLIF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|