C14H16INS — CID 79693474
1-(2,4-dimethylphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine (PubChem CID 79693474) has the molecular formula C14H16INS and a molecular weight of 357.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(2,4-dimethylphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 79693474 |
| Molecular Formula | C14H16INS |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc(I)c1)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H16INS/c1-9-4-5-12(10(2)6-9)14(16-3)11-7-13(15)17-8-11/h4-8,14,16H,1-3H3 |
| InChIKey | DVQQGGIFOIJTHJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|