C16H20N2 — CID 116952017
4-[(2,4-dimethylphenyl)-(methylamino)methyl]aniline (PubChem CID 116952017) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)-(methylamino)methyl]aniline.
| Compound Name | 4-[(2,4-dimethylphenyl)-(methylamino)methyl]aniline |
|---|---|
| PubChem CID | 116952017 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)-(methylamino)methyl]aniline |
| SMILES | CNC(c1ccc(N)cc1)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H20N2/c1-11-4-9-15(12(2)10-11)16(18-3)13-5-7-14(17)8-6-13/h4-10,16,18H,17H2,1-3H3 |
| InChIKey | KPTMQYZTDBIPMX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|