C12H10BrClFNS — CID 80529266
1-(5-bromo-2-fluorophenyl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine (PubChem CID 80529266) has the molecular formula C12H10BrClFNS and a molecular weight of 334.64 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 80529266 |
| Molecular Formula | C12H10BrClFNS |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Br)ccc1F)c1sccc1Cl |
| InChI | InChI=1S/C12H10BrClFNS/c1-16-11(12-9(14)4-5-17-12)8-6-7(13)2-3-10(8)15/h2-6,11,16H,1H3 |
| InChIKey | QEUHPTDSHADCKX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |