C13H11F4N3 — CID 107291869
1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-pyridazin-4-ylmethanamine (PubChem CID 107291869) has the molecular formula C13H11F4N3 and a molecular weight of 285.24 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-pyridazin-4-ylmethanamine.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-pyridazin-4-ylmethanamine |
|---|---|
| PubChem CID | 107291869 |
| Molecular Formula | C13H11F4N3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-N-methyl-1-pyridazin-4-ylmethanamine |
| SMILES | CNC(c1ccnnc1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F4N3/c1-18-12(9-4-5-19-20-7-9)8-2-3-11(14)10(6-8)13(15,16)17/h2-7,12,18H,1H3 |
| InChIKey | MQULBPFBKAYUDX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |