C14H11BrF4N2 — CID 105038403
1-[4-bromo-3-(trifluoromethyl)phenyl]-1-(3-fluoro-4-pyridinyl)-N-methylmethanamine (PubChem CID 105038403) has the molecular formula C14H11BrF4N2 and a molecular weight of 363.15 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-1-(3-fluoro-4-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-1-(3-fluoro-4-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105038403 |
| Molecular Formula | C14H11BrF4N2 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-1-(3-fluoro-4-pyridinyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Br)c(C(F)(F)F)c1)c1ccncc1F |
| InChI | InChI=1S/C14H11BrF4N2/c1-20-13(9-4-5-21-7-12(9)16)8-2-3-11(15)10(6-8)14(17,18)19/h2-7,13,20H,1H3 |
| InChIKey | POXAJRMLDCBNFY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |