C15H17FINS — CID 79747223
N-[(4-fluoro-3-methylphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine (PubChem CID 79747223) has the molecular formula C15H17FINS and a molecular weight of 389.28 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(4-fluoro-3-methylphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79747223 |
| Molecular Formula | C15H17FINS |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C15H17FINS/c1-3-6-18-15(12-8-14(17)19-9-12)11-4-5-13(16)10(2)7-11/h4-5,7-9,15,18H,3,6H2,1-2H3 |
| InChIKey | GMLIWWWTFJHEED-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|