C18H22IN — CID 43493978
N-[(3,4-dimethylphenyl)-(4-iodophenyl)methyl]propan-1-amine (PubChem CID 43493978) has the molecular formula C18H22IN and a molecular weight of 379.29 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)-(4-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[(3,4-dimethylphenyl)-(4-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43493978 |
| Molecular Formula | C18H22IN |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[(3,4-dimethylphenyl)-(4-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)cc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H22IN/c1-4-11-20-18(15-7-9-17(19)10-8-15)16-6-5-13(2)14(3)12-16/h5-10,12,18,20H,4,11H2,1-3H3 |
| InChIKey | AQVLGUMFXOQFPH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|