C13H16INOS — CID 79692841
N-[(5-iodothiophen-3-yl)-(5-methylfuran-2-yl)methyl]propan-1-amine (PubChem CID 79692841) has the molecular formula C13H16INOS and a molecular weight of 361.25 g/mol. Its IUPAC name is N-[(5-iodothiophen-3-yl)-(5-methylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-iodothiophen-3-yl)-(5-methylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79692841 |
| Molecular Formula | C13H16INOS |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | N-[(5-iodothiophen-3-yl)-(5-methylfuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1ccc(C)o1 |
| InChI | InChI=1S/C13H16INOS/c1-3-6-15-13(10-7-12(14)17-8-10)11-5-4-9(2)16-11/h4-5,7-8,13,15H,3,6H2,1-2H3 |
| InChIKey | HXUWRBKRZNBKHJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|