C16H20INOS — CID 79693925
N-[(5-iodothiophen-3-yl)-(4-methoxy-2-methylphenyl)methyl]propan-1-amine (PubChem CID 79693925) has the molecular formula C16H20INOS and a molecular weight of 401.31 g/mol. Its IUPAC name is N-[(5-iodothiophen-3-yl)-(4-methoxy-2-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-iodothiophen-3-yl)-(4-methoxy-2-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79693925 |
| Molecular Formula | C16H20INOS |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[(5-iodothiophen-3-yl)-(4-methoxy-2-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1ccc(OC)cc1C |
| InChI | InChI=1S/C16H20INOS/c1-4-7-18-16(12-9-15(17)20-10-12)14-6-5-13(19-3)8-11(14)2/h5-6,8-10,16,18H,4,7H2,1-3H3 |
| InChIKey | QSPXDXUYNDPOQQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|