C14H18INS2 — CID 81156181
N-[(3,5-dimethylthiophen-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine (PubChem CID 81156181) has the molecular formula C14H18INS2 and a molecular weight of 391.34 g/mol. Its IUPAC name is N-[(3,5-dimethylthiophen-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(3,5-dimethylthiophen-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81156181 |
| Molecular Formula | C14H18INS2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | N-[(3,5-dimethylthiophen-2-yl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1sc(C)cc1C |
| InChI | InChI=1S/C14H18INS2/c1-4-5-16-13(11-7-12(15)17-8-11)14-9(2)6-10(3)18-14/h6-8,13,16H,4-5H2,1-3H3 |
| InChIKey | FWGXHYIWNJGQJW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|