C16H19BrINOS — CID 104657751
N-[(3-bromo-4-ethoxyphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine (PubChem CID 104657751) has the molecular formula C16H19BrINOS and a molecular weight of 480.21 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxyphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-4-ethoxyphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104657751 |
| Molecular Formula | C16H19BrINOS |
| Molecular Weight | 480.21 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | N-[(3-bromo-4-ethoxyphenyl)-(5-iodothiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(I)c1)c1ccc(OCC)c(Br)c1 |
| InChI | InChI=1S/C16H19BrINOS/c1-3-7-19-16(12-9-15(18)21-10-12)11-5-6-14(20-4-2)13(17)8-11/h5-6,8-10,16,19H,3-4,7H2,1-2H3 |
| InChIKey | KZKVMCAWZNFCRF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|