C16H19Br2NOS — CID 107961353
N-[(3-bromo-4-propoxyphenyl)-(5-bromothiophen-3-yl)methyl]ethanamine (PubChem CID 107961353) has the molecular formula C16H19Br2NOS and a molecular weight of 433.21 g/mol. Its IUPAC name is N-[(3-bromo-4-propoxyphenyl)-(5-bromothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-propoxyphenyl)-(5-bromothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107961353 |
| Molecular Formula | C16H19Br2NOS |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | N-[(3-bromo-4-propoxyphenyl)-(5-bromothiophen-3-yl)methyl]ethanamine |
| SMILES | CCCOc1ccc(C(NCC)c2csc(Br)c2)cc1Br |
| InChI | InChI=1S/C16H19Br2NOS/c1-3-7-20-14-6-5-11(8-13(14)17)16(19-4-2)12-9-15(18)21-10-12/h5-6,8-10,16,19H,3-4,7H2,1-2H3 |
| InChIKey | BNXLGADLVFHZSM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |