C15H18BrF2N3 — CID 106944472
N-[(3-bromo-2,6-difluorophenyl)-(2,5-dimethylpyrazol-3-yl)methyl]propan-1-amine (PubChem CID 106944472) has the molecular formula C15H18BrF2N3 and a molecular weight of 358.23 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(2,5-dimethylpyrazol-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(2,5-dimethylpyrazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106944472 |
| Molecular Formula | C15H18BrF2N3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(2,5-dimethylpyrazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1c(F)ccc(Br)c1F)c1cc(C)nn1C |
| InChI | InChI=1S/C15H18BrF2N3/c1-4-7-19-15(12-8-9(2)20-21(12)3)13-11(17)6-5-10(16)14(13)18/h5-6,8,15,19H,4,7H2,1-3H3 |
| InChIKey | INMWRJOEKHNWJI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|