C13H13BrF2N2S — CID 106942877
N-[(3-bromo-2,6-difluorophenyl)-(1,3-thiazol-5-yl)methyl]propan-1-amine (PubChem CID 106942877) has the molecular formula C13H13BrF2N2S and a molecular weight of 347.23 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)-(1,3-thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)-(1,3-thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106942877 |
| Molecular Formula | C13H13BrF2N2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)-(1,3-thiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cncs1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H13BrF2N2S/c1-2-5-18-13(10-6-17-7-19-10)11-9(15)4-3-8(14)12(11)16/h3-4,6-7,13,18H,2,5H2,1H3 |
| InChIKey | VRPXGTVRGKNYRA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|