C14H15BrF2N2S — CID 106268147
N-[2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethyl]propan-1-amine (PubChem CID 106268147) has the molecular formula C14H15BrF2N2S and a molecular weight of 361.26 g/mol. Its IUPAC name is N-[2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106268147 |
| Molecular Formula | C14H15BrF2N2S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(F)ccc(Br)c1F)c1cncs1 |
| InChI | InChI=1S/C14H15BrF2N2S/c1-2-5-19-12(13-7-18-8-20-13)6-9-11(16)4-3-10(15)14(9)17/h3-4,7-8,12,19H,2,5-6H2,1H3 |
| InChIKey | GFCQLGIDWKPGFE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|