C15H15BrClF2NS — CID 106274329
N-[2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 106274329) has the molecular formula C15H15BrClF2NS and a molecular weight of 394.71 g/mol. Its IUPAC name is N-[2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106274329 |
| Molecular Formula | C15H15BrClF2NS |
| Molecular Weight | 394.71 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(F)ccc(Br)c1F)c1sccc1Cl |
| InChI | InChI=1S/C15H15BrClF2NS/c1-2-6-20-13(15-11(17)5-7-21-15)8-9-12(18)4-3-10(16)14(9)19/h3-5,7,13,20H,2,6,8H2,1H3 |
| InChIKey | NFCMIGVZQCPYOH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|