C12H9BrClF2NS — CID 106274096
2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethanamine (PubChem CID 106274096) has the molecular formula C12H9BrClF2NS and a molecular weight of 352.63 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 106274096 |
| Molecular Formula | C12H9BrClF2NS |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-chlorothiophen-2-yl)ethanamine |
| SMILES | NC(Cc1c(F)ccc(Br)c1F)c1sccc1Cl |
| InChI | InChI=1S/C12H9BrClF2NS/c13-7-1-2-9(15)6(11(7)16)5-10(17)12-8(14)3-4-18-12/h1-4,10H,5,17H2 |
| InChIKey | XHSPUKLZZYGMPD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|