C15H16BrCl2NS — CID 105037954
N-[2-(4-bromo-2-chlorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine (PubChem CID 105037954) has the molecular formula C15H16BrCl2NS and a molecular weight of 393.18 g/mol. Its IUPAC name is N-[2-(4-bromo-2-chlorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-bromo-2-chlorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105037954 |
| Molecular Formula | C15H16BrCl2NS |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | N-[2-(4-bromo-2-chlorophenyl)-1-(3-chlorothiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)cc1Cl)c1sccc1Cl |
| InChI | InChI=1S/C15H16BrCl2NS/c1-2-6-19-14(15-12(17)5-7-20-15)8-10-3-4-11(16)9-13(10)18/h3-5,7,9,14,19H,2,6,8H2,1H3 |
| InChIKey | QLCTXRYGHCZIQF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |