C13H16ClNS2 — CID 80645193
N-[1-(3-chlorothiophen-2-yl)-2-thiophen-3-ylethyl]propan-1-amine (PubChem CID 80645193) has the molecular formula C13H16ClNS2 and a molecular weight of 285.86 g/mol. Its IUPAC name is N-[1-(3-chlorothiophen-2-yl)-2-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[1-(3-chlorothiophen-2-yl)-2-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 80645193 |
| Molecular Formula | C13H16ClNS2 |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-[1-(3-chlorothiophen-2-yl)-2-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccsc1)c1sccc1Cl |
| InChI | InChI=1S/C13H16ClNS2/c1-2-5-15-12(8-10-3-6-16-9-10)13-11(14)4-7-17-13/h3-4,6-7,9,12,15H,2,5,8H2,1H3 |
| InChIKey | GZKDZNMELIVKGT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |