C11H18ClNS2 — CID 107359767
N-[1-(3-chlorothiophen-2-yl)-2-ethylsulfanylethyl]propan-1-amine (PubChem CID 107359767) has the molecular formula C11H18ClNS2 and a molecular weight of 263.86 g/mol. Its IUPAC name is N-[1-(3-chlorothiophen-2-yl)-2-ethylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(3-chlorothiophen-2-yl)-2-ethylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 107359767 |
| Molecular Formula | C11H18ClNS2 |
| Molecular Weight | 263.86 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-[1-(3-chlorothiophen-2-yl)-2-ethylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSCC)c1sccc1Cl |
| InChI | InChI=1S/C11H18ClNS2/c1-3-6-13-10(8-14-4-2)11-9(12)5-7-15-11/h5,7,10,13H,3-4,6,8H2,1-2H3 |
| InChIKey | ZTYKOOLXRZJBFP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |