C12H20ClNS2 — CID 107359771
N-[1-(3-chlorothiophen-2-yl)-2-propylsulfanylethyl]propan-1-amine (PubChem CID 107359771) has the molecular formula C12H20ClNS2 and a molecular weight of 277.89 g/mol. Its IUPAC name is N-[1-(3-chlorothiophen-2-yl)-2-propylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(3-chlorothiophen-2-yl)-2-propylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 107359771 |
| Molecular Formula | C12H20ClNS2 |
| Molecular Weight | 277.89 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[1-(3-chlorothiophen-2-yl)-2-propylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSCCC)c1sccc1Cl |
| InChI | InChI=1S/C12H20ClNS2/c1-3-6-14-11(9-15-7-4-2)12-10(13)5-8-16-12/h5,8,11,14H,3-4,6-7,9H2,1-2H3 |
| InChIKey | XXBFIJORISQMNZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.89 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|