C10H16ClNS2 — CID 107359766
1-(3-chlorothiophen-2-yl)-N-ethyl-2-ethylsulfanylethanamine (PubChem CID 107359766) has the molecular formula C10H16ClNS2 and a molecular weight of 249.83 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-ethyl-2-ethylsulfanylethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-ethylsulfanylethanamine |
|---|---|
| PubChem CID | 107359766 |
| Molecular Formula | C10H16ClNS2 |
| Molecular Weight | 249.83 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-ethylsulfanylethanamine |
| SMILES | CCNC(CSCC)c1sccc1Cl |
| InChI | InChI=1S/C10H16ClNS2/c1-3-12-9(7-13-4-2)10-8(11)5-6-14-10/h5-6,9,12H,3-4,7H2,1-2H3 |
| InChIKey | XXOMPGGNIVTLNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |