C11H18ClNS2 — CID 107359774
1-(3-chlorothiophen-2-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine (PubChem CID 107359774) has the molecular formula C11H18ClNS2 and a molecular weight of 263.86 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine |
|---|---|
| PubChem CID | 107359774 |
| Molecular Formula | C11H18ClNS2 |
| Molecular Weight | 263.86 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-propan-2-ylsulfanylethanamine |
| SMILES | CCNC(CSC(C)C)c1sccc1Cl |
| InChI | InChI=1S/C11H18ClNS2/c1-4-13-10(7-15-8(2)3)11-9(12)5-6-14-11/h5-6,8,10,13H,4,7H2,1-3H3 |
| InChIKey | PAGBZAMYMWEJIM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |