C13H20ClNS2 — CID 107361859
1-(3-chlorothiophen-2-yl)-N-ethyl-2-(thian-4-yl)ethanamine (PubChem CID 107361859) has the molecular formula C13H20ClNS2 and a molecular weight of 289.90 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(thian-4-yl)ethanamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 107361859 |
| Molecular Formula | C13H20ClNS2 |
| Molecular Weight | 289.90 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N-ethyl-2-(thian-4-yl)ethanamine |
| SMILES | CCNC(CC1CCSCC1)c1sccc1Cl |
| InChI | InChI=1S/C13H20ClNS2/c1-2-15-12(13-11(14)5-8-17-13)9-10-3-6-16-7-4-10/h5,8,10,12,15H,2-4,6-7,9H2,1H3 |
| InChIKey | WUPRUEIVYQRMIV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |