C13H20ClNOS — CID 107360148
N-[1-(3-chlorothiophen-2-yl)-2-(oxolan-3-yl)ethyl]propan-1-amine (PubChem CID 107360148) has the molecular formula C13H20ClNOS and a molecular weight of 273.83 g/mol. Its IUPAC name is N-[1-(3-chlorothiophen-2-yl)-2-(oxolan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(3-chlorothiophen-2-yl)-2-(oxolan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107360148 |
| Molecular Formula | C13H20ClNOS |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[1-(3-chlorothiophen-2-yl)-2-(oxolan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CCOC1)c1sccc1Cl |
| InChI | InChI=1S/C13H20ClNOS/c1-2-5-15-12(8-10-3-6-16-9-10)13-11(14)4-7-17-13/h4,7,10,12,15H,2-3,5-6,8-9H2,1H3 |
| InChIKey | BYAXPGKCZFUFSX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |