C15H21Cl2NS — CID 105077128
1-(3,4-dichlorophenyl)-N-ethyl-2-(thian-4-yl)ethanamine (PubChem CID 105077128) has the molecular formula C15H21Cl2NS and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-ethyl-2-(thian-4-yl)ethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-ethyl-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 105077128 |
| Molecular Formula | C15H21Cl2NS |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-ethyl-2-(thian-4-yl)ethanamine |
| SMILES | CCNC(CC1CCSCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2NS/c1-2-18-15(9-11-5-7-19-8-6-11)12-3-4-13(16)14(17)10-12/h3-4,10-11,15,18H,2,5-9H2,1H3 |
| InChIKey | FZIMEKHIMVSHEW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |