C14H25N3S — CID 105148508
N-ethyl-1-(2-ethylpyrazol-3-yl)-2-(thian-4-yl)ethanamine (PubChem CID 105148508) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is N-ethyl-1-(2-ethylpyrazol-3-yl)-2-(thian-4-yl)ethanamine.
| Compound Name | N-ethyl-1-(2-ethylpyrazol-3-yl)-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 105148508 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-ethyl-1-(2-ethylpyrazol-3-yl)-2-(thian-4-yl)ethanamine |
| SMILES | CCNC(CC1CCSCC1)c1ccnn1CC |
| InChI | InChI=1S/C14H25N3S/c1-3-15-13(11-12-6-9-18-10-7-12)14-5-8-16-17(14)4-2/h5,8,12-13,15H,3-4,6-7,9-11H2,1-2H3 |
| InChIKey | VFPWGXHTXQBQKJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |