C14H19Cl2N — CID 43776540
N-(1-cyclopropylethyl)-1-(3,4-dichlorophenyl)propan-1-amine (PubChem CID 43776540) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-1-(3,4-dichlorophenyl)propan-1-amine.
| Compound Name | N-(1-cyclopropylethyl)-1-(3,4-dichlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 43776540 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-(1-cyclopropylethyl)-1-(3,4-dichlorophenyl)propan-1-amine |
| SMILES | CCC(NC(C)C1CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2N/c1-3-14(17-9(2)10-4-5-10)11-6-7-12(15)13(16)8-11/h6-10,14,17H,3-5H2,1-2H3 |
| InChIKey | NVUMMDGBVZSVMX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |