C17H25Cl2N — CID 63454246
N-[1-(3,4-dichlorophenyl)propyl]-4-ethylcyclohexan-1-amine (PubChem CID 63454246) has the molecular formula C17H25Cl2N and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)propyl]-4-ethylcyclohexan-1-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)propyl]-4-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63454246 |
| Molecular Formula | C17H25Cl2N |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)propyl]-4-ethylcyclohexan-1-amine |
| SMILES | CCC1CCC(NC(CC)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25Cl2N/c1-3-12-5-8-14(9-6-12)20-17(4-2)13-7-10-15(18)16(19)11-13/h7,10-12,14,17,20H,3-6,8-9H2,1-2H3 |
| InChIKey | QGNQYLICKWWTGF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |