C15H22Cl2N2 — CID 65381340
N-cycloheptyl-1-(3,4-dichlorophenyl)ethane-1,2-diamine (PubChem CID 65381340) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is N-cycloheptyl-1-(3,4-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | N-cycloheptyl-1-(3,4-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65381340 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | N-cycloheptyl-1-(3,4-dichlorophenyl)ethane-1,2-diamine |
| SMILES | NCC(NC1CCCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2/c16-13-8-7-11(9-14(13)17)15(10-18)19-12-5-3-1-2-4-6-12/h7-9,12,15,19H,1-6,10,18H2 |
| InChIKey | KSHZYULORRGDFW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |