C14H22BrN3 — CID 113469387
1-(5-bromo-3-pyridinyl)-N-cycloheptylethane-1,2-diamine (PubChem CID 113469387) has the molecular formula C14H22BrN3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-cycloheptylethane-1,2-diamine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-cycloheptylethane-1,2-diamine |
|---|---|
| PubChem CID | 113469387 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-cycloheptylethane-1,2-diamine |
| SMILES | NCC(NC1CCCCCC1)c1cncc(Br)c1 |
| InChI | InChI=1S/C14H22BrN3/c15-12-7-11(9-17-10-12)14(8-16)18-13-5-3-1-2-4-6-13/h7,9-10,13-14,18H,1-6,8,16H2 |
| InChIKey | BFJUDKKEVAGMEN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |