C12H22N4 — CID 103569652
N-cyclopentyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine (PubChem CID 103569652) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N-cyclopentyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine.
| Compound Name | N-cyclopentyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103569652 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-cyclopentyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine |
| SMILES | CCn1cc(C(CN)NC2CCCC2)cn1 |
| InChI | InChI=1S/C12H22N4/c1-2-16-9-10(8-14-16)12(7-13)15-11-5-3-4-6-11/h8-9,11-12,15H,2-7,13H2,1H3 |
| InChIKey | SHXHNUALLIVMOV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |