C11H20N4 — CID 103569730
N-but-3-enyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine (PubChem CID 103569730) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N-but-3-enyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine.
| Compound Name | N-but-3-enyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103569730 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-but-3-enyl-1-(1-ethylpyrazol-4-yl)ethane-1,2-diamine |
| SMILES | C=CCCNC(CN)c1cnn(CC)c1 |
| InChI | InChI=1S/C11H20N4/c1-3-5-6-13-11(7-12)10-8-14-15(4-2)9-10/h3,8-9,11,13H,1,4-7,12H2,2H3 |
| InChIKey | DFXJNHPYDZFYEN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|