C13H22N2S — CID 65381151
N-cycloheptyl-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 65381151) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-cycloheptyl-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | N-cycloheptyl-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 65381151 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-cycloheptyl-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | NCC(NC1CCCCCC1)c1ccsc1 |
| InChI | InChI=1S/C13H22N2S/c14-9-13(11-7-8-16-10-11)15-12-5-3-1-2-4-6-12/h7-8,10,12-13,15H,1-6,9,14H2 |
| InChIKey | IAOIVWXFFFEGBL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |