C9H16N2S — CID 62064771
N-propan-2-yl-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 62064771) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N-propan-2-yl-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | N-propan-2-yl-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62064771 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-propan-2-yl-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | CC(C)NC(CN)c1ccsc1 |
| InChI | InChI=1S/C9H16N2S/c1-7(2)11-9(5-10)8-3-4-12-6-8/h3-4,6-7,9,11H,5,10H2,1-2H3 |
| InChIKey | QUTVBQGKKYJGOK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |