C12H13BrN2S — CID 65384490
N-(2-bromophenyl)-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 65384490) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is N-(2-bromophenyl)-1-thiophen-3-ylethane-1,2-diamine.
| Compound Name | N-(2-bromophenyl)-1-thiophen-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 65384490 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | N-(2-bromophenyl)-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Br)c1ccsc1 |
| InChI | InChI=1S/C12H13BrN2S/c13-10-3-1-2-4-11(10)15-12(7-14)9-5-6-16-8-9/h1-6,8,12,15H,7,14H2 |
| InChIKey | WESYAKLYUNDZAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |