C14H14BrClN2 — CID 65378132
1-(4-bromophenyl)-N-(2-chlorophenyl)ethane-1,2-diamine (PubChem CID 65378132) has the molecular formula C14H14BrClN2 and a molecular weight of 325.64 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-(2-chlorophenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-bromophenyl)-N-(2-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65378132 |
| Molecular Formula | C14H14BrClN2 |
| Molecular Weight | 325.64 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1-(4-bromophenyl)-N-(2-chlorophenyl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14BrClN2/c15-11-7-5-10(6-8-11)14(9-17)18-13-4-2-1-3-12(13)16/h1-8,14,18H,9,17H2 |
| InChIKey | LTWWSTXCHIENMO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |