C13H14ClN3 — CID 79840947
N-(3-chloro-4-pyridinyl)-1-phenylethane-1,2-diamine (PubChem CID 79840947) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-1-phenylethane-1,2-diamine.
| Compound Name | N-(3-chloro-4-pyridinyl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 79840947 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-1-phenylethane-1,2-diamine |
| SMILES | NCC(Nc1ccncc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H14ClN3/c14-11-9-16-7-6-12(11)17-13(8-15)10-4-2-1-3-5-10/h1-7,9,13H,8,15H2,(H,16,17) |
| InChIKey | AKFKQPXKVKWKME-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |