C14H14Br2N2 — CID 65384493
N,1-bis(2-bromophenyl)ethane-1,2-diamine (PubChem CID 65384493) has the molecular formula C14H14Br2N2 and a molecular weight of 370.09 g/mol. Its IUPAC name is N,1-bis(2-bromophenyl)ethane-1,2-diamine.
| Compound Name | N,1-bis(2-bromophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65384493 |
| Molecular Formula | C14H14Br2N2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | N,1-bis(2-bromophenyl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Br)c1ccccc1Br |
| InChI | InChI=1S/C14H14Br2N2/c15-11-6-2-1-5-10(11)14(9-17)18-13-8-4-3-7-12(13)16/h1-8,14,18H,9,17H2 |
| InChIKey | YZMOAQVLHWXKEV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |