C9H16N2S — CID 134307108
(1S)-N,N-dimethyl-1-thiophen-3-ylpropane-1,3-diamine (PubChem CID 134307108) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-thiophen-3-ylpropane-1,3-diamine.
| Compound Name | (1S)-N,N-dimethyl-1-thiophen-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 134307108 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (1S)-N,N-dimethyl-1-thiophen-3-ylpropane-1,3-diamine |
| SMILES | CN(C)[C@@H](CCN)c1ccsc1 |
| InChI | InChI=1S/C9H16N2S/c1-11(2)9(3-5-10)8-4-6-12-7-8/h4,6-7,9H,3,5,10H2,1-2H3/t9-/m0/s1 |
| InChIKey | PSRQNUXURMUKBJ-VIFPVBQESA-N |
| XLogP | 1.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |