C8H14N2OS — CID 83927672
2,4-diamino-1-thiophen-3-ylbutan-1-ol (PubChem CID 83927672) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2,4-diamino-1-thiophen-3-ylbutan-1-ol.
| Compound Name | 2,4-diamino-1-thiophen-3-ylbutan-1-ol |
|---|---|
| PubChem CID | 83927672 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2,4-diamino-1-thiophen-3-ylbutan-1-ol |
| SMILES | NCCC(N)C(O)c1ccsc1 |
| InChI | InChI=1S/C8H14N2OS/c9-3-1-7(10)8(11)6-2-4-12-5-6/h2,4-5,7-8,11H,1,3,9-10H2 |
| InChIKey | IUDGAKYSGHSYHY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |