C13H22N2O3S — CID 83927676
tert-butyl N-(3-amino-4-hydroxy-4-thiophen-3-ylbutyl)carbamate (PubChem CID 83927676) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is tert-butyl N-(3-amino-4-hydroxy-4-thiophen-3-ylbutyl)carbamate.
| Compound Name | tert-butyl N-(3-amino-4-hydroxy-4-thiophen-3-ylbutyl)carbamate |
|---|---|
| PubChem CID | 83927676 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | tert-butyl N-(3-amino-4-hydroxy-4-thiophen-3-ylbutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(N)C(O)c1ccsc1 |
| InChI | InChI=1S/C13H22N2O3S/c1-13(2,3)18-12(17)15-6-4-10(14)11(16)9-5-7-19-8-9/h5,7-8,10-11,16H,4,6,14H2,1-3H3,(H,15,17) |
| InChIKey | BBTPBIVELJEEDA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |