C15H23ClN2O3 — CID 83924561
tert-butyl N-[3-amino-4-(3-chlorophenyl)-4-hydroxybutyl]carbamate (PubChem CID 83924561) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is tert-butyl N-[3-amino-4-(3-chlorophenyl)-4-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-4-(3-chlorophenyl)-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 83924561 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | tert-butyl N-[3-amino-4-(3-chlorophenyl)-4-hydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(N)C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O3/c1-15(2,3)21-14(20)18-8-7-12(17)13(19)10-5-4-6-11(16)9-10/h4-6,9,12-13,19H,7-8,17H2,1-3H3,(H,18,20) |
| InChIKey | BBEUZVKKAKZTDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |