C15H24N2S — CID 65384746
N-cyclohexyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine (PubChem CID 65384746) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is N-cyclohexyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclohexyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65384746 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N-cyclohexyl-1-(4-methylsulfanylphenyl)ethane-1,2-diamine |
| SMILES | CSc1ccc(C(CN)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H24N2S/c1-18-14-9-7-12(8-10-14)15(11-16)17-13-5-3-2-4-6-13/h7-10,13,15,17H,2-6,11,16H2,1H3 |
| InChIKey | RLXZKSIQOSXBSI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |