C13H20N2O — CID 105476319
N-cyclobutyl-1-(4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 105476319) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-cyclobutyl-1-(4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-cyclobutyl-1-(4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 105476319 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-cyclobutyl-1-(4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(C(CN)NC2CCC2)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-16-12-7-5-10(6-8-12)13(9-14)15-11-3-2-4-11/h5-8,11,13,15H,2-4,9,14H2,1H3 |
| InChIKey | QCPDNLDHFZDRCQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |